C18H22O5 — CID 25208649
ethyl (1S,2R,3R,5R)-5-(2-hydroxypropan-2-yl)-7-oxo-2-phenyl-6-oxabicyclo[3.2.0]heptane-3-carboxylate (PubChem CID 25208649) has the molecular formula C18H22O5 and a molecular weight of 318.37 g/mol. Its IUPAC name is ethyl (1S,2R,3R,5R)-5-(2-hydroxypropan-2-yl)-7-oxo-2-phenyl-6-oxabicyclo[3.2.0]heptane-3-carboxylate.
| Compound Name | ethyl (1S,2R,3R,5R)-5-(2-hydroxypropan-2-yl)-7-oxo-2-phenyl-6-oxabicyclo[3.2.0]heptane-3-carboxylate |
|---|---|
| PubChem CID | 25208649 |
| Molecular Formula | C18H22O5 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | ethyl (1S,2R,3R,5R)-5-(2-hydroxypropan-2-yl)-7-oxo-2-phenyl-6-oxabicyclo[3.2.0]heptane-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@@]2(C(C)(C)O)OC(=O)[C@H]2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C18H22O5/c1-4-22-15(19)12-10-18(17(2,3)21)14(16(20)23-18)13(12)11-8-6-5-7-9-11/h5-9,12-14,21H,4,10H2,1-3H3/t12-,13-,14-,18-/m1/s1 |
| InChIKey | YOLJKEQRCNYXRN-UHQDVWGKSA-N |
| XLogP | 2.04 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|