C17H18O6 — CID 166439613
dimethyl (1R,4R,5S)-5-methyl-7-oxo-4-phenyl-6-oxabicyclo[3.2.0]heptane-2,2-dicarboxylate (PubChem CID 166439613) has the molecular formula C17H18O6 and a molecular weight of 318.33 g/mol. Its IUPAC name is dimethyl (1R,4R,5S)-5-methyl-7-oxo-4-phenyl-6-oxabicyclo[3.2.0]heptane-2,2-dicarboxylate.
| Compound Name | dimethyl (1R,4R,5S)-5-methyl-7-oxo-4-phenyl-6-oxabicyclo[3.2.0]heptane-2,2-dicarboxylate |
|---|---|
| PubChem CID | 166439613 |
| Molecular Formula | C17H18O6 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | dimethyl (1R,4R,5S)-5-methyl-7-oxo-4-phenyl-6-oxabicyclo[3.2.0]heptane-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@H](c2ccccc2)[C@]2(C)OC(=O)[C@H]12 |
| InChI | InChI=1S/C17H18O6/c1-16-11(10-7-5-4-6-8-10)9-17(14(19)21-2,15(20)22-3)12(16)13(18)23-16/h4-8,11-12H,9H2,1-3H3/t11-,12+,16+/m1/s1 |
| InChIKey | XGASIZWSYROBFI-WQGACYEGSA-N |
| XLogP | 1.44 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|