C22H28O5 — CID 139252616
dimethyl (4Z)-3-(2-methoxypropan-2-yl)-4-[(E)-3-phenylprop-2-enylidene]cyclopentane-1,1-dicarboxylate (PubChem CID 139252616) has the molecular formula C22H28O5 and a molecular weight of 372.46 g/mol. Its IUPAC name is dimethyl (4Z)-3-(2-methoxypropan-2-yl)-4-[(E)-3-phenylprop-2-enylidene]cyclopentane-1,1-dicarboxylate.
| Compound Name | dimethyl (4Z)-3-(2-methoxypropan-2-yl)-4-[(E)-3-phenylprop-2-enylidene]cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 139252616 |
| Molecular Formula | C22H28O5 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | dimethyl (4Z)-3-(2-methoxypropan-2-yl)-4-[(E)-3-phenylprop-2-enylidene]cyclopentane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C/C(=C/C=C/c2ccccc2)C(C(C)(C)OC)C1 |
| InChI | InChI=1S/C22H28O5/c1-21(2,27-5)18-15-22(19(23)25-3,20(24)26-4)14-17(18)13-9-12-16-10-7-6-8-11-16/h6-13,18H,14-15H2,1-5H3/b12-9+,17-13- |
| InChIKey | UBHSPBPXYFLABR-XTPUDKEYSA-N |
| XLogP | 3.79 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|