C23H36O4 — CID 85128188
methyl 2-[3,5-dimethyl-5-(2-methyl-8-phenyloctyl)dioxolan-3-yl]acetate (PubChem CID 85128188) has the molecular formula C23H36O4 and a molecular weight of 376.54 g/mol. Its IUPAC name is methyl 2-[3,5-dimethyl-5-(2-methyl-8-phenyloctyl)dioxolan-3-yl]acetate.
| Compound Name | methyl 2-[3,5-dimethyl-5-(2-methyl-8-phenyloctyl)dioxolan-3-yl]acetate |
|---|---|
| PubChem CID | 85128188 |
| Molecular Formula | C23H36O4 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | methyl 2-[3,5-dimethyl-5-(2-methyl-8-phenyloctyl)dioxolan-3-yl]acetate |
| SMILES | COC(=O)CC1(C)CC(C)(CC(C)CCCCCCc2ccccc2)OO1 |
| InChI | InChI=1S/C23H36O4/c1-19(12-8-5-6-9-13-20-14-10-7-11-15-20)16-22(2)18-23(3,27-26-22)17-21(24)25-4/h7,10-11,14-15,19H,5-6,8-9,12-13,16-18H2,1-4H3 |
| InChIKey | RYNXSVDLWWRGRW-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|