C22H24O5 — CID 102286660
diethyl (1R,5S,8S)-7-phenyl-11-oxatricyclo[6.2.1.01,5]undeca-6,9-diene-3,3-dicarboxylate (PubChem CID 102286660) has the molecular formula C22H24O5 and a molecular weight of 368.43 g/mol. Its IUPAC name is diethyl (1R,5S,8S)-7-phenyl-11-oxatricyclo[6.2.1.01,5]undeca-6,9-diene-3,3-dicarboxylate.
| Compound Name | diethyl (1R,5S,8S)-7-phenyl-11-oxatricyclo[6.2.1.01,5]undeca-6,9-diene-3,3-dicarboxylate |
|---|---|
| PubChem CID | 102286660 |
| Molecular Formula | C22H24O5 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | diethyl (1R,5S,8S)-7-phenyl-11-oxatricyclo[6.2.1.01,5]undeca-6,9-diene-3,3-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C[C@H]2C=C(c3ccccc3)[C@@H]3C=C[C@@]2(C1)O3 |
| InChI | InChI=1S/C22H24O5/c1-3-25-19(23)21(20(24)26-4-2)13-16-12-17(15-8-6-5-7-9-15)18-10-11-22(16,14-21)27-18/h5-12,16,18H,3-4,13-14H2,1-2H3/t16-,18+,22+/m1/s1 |
| InChIKey | ZEONLRSRUYAKGQ-NRJQMVOHSA-N |
| XLogP | 3.30 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|