C33H46O5Si — CID 134849806
trans-dibenzyl (3S,4R)-4-ethenyl-3-methyl-3-tri(propan-2-yl)silyloxycyclopentane-1,1-dicarboxylate (PubChem CID 134849806) has the molecular formula C33H46O5Si and a molecular weight of 550.81 g/mol. Its IUPAC name is trans-dibenzyl (3S,4R)-4-ethenyl-3-methyl-3-tri(propan-2-yl)silyloxycyclopentane-1,1-dicarboxylate.
| Compound Name | trans-dibenzyl (3S,4R)-4-ethenyl-3-methyl-3-tri(propan-2-yl)silyloxycyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 134849806 |
| Molecular Formula | C33H46O5Si |
| Molecular Weight | 550.81 g/mol |
| Exact Mass | 550.31 |
| IUPAC Name | trans-dibenzyl (3S,4R)-4-ethenyl-3-methyl-3-tri(propan-2-yl)silyloxycyclopentane-1,1-dicarboxylate |
| SMILES | C=C[C@H]1CC(C(=O)OCc2ccccc2)(C(=O)OCc2ccccc2)C[C@]1(C)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C33H46O5Si/c1-9-29-20-33(30(34)36-21-27-16-12-10-13-17-27,31(35)37-22-28-18-14-11-15-19-28)23-32(29,8)38-39(24(2)3,25(4)5)26(6)7/h9-19,24-26,29H,1,20-23H2,2-8H3/t29-,32-/m0/s1 |
| InChIKey | WXJFWLZPMXFZBR-NYDCQLBNSA-N |
| XLogP | 8.01 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.81 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|