C32H48O6Si — CID 10530833
ethyl (2S,3S,4S)-6-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4-phenylmethoxy-3-(phenylmethoxymethyl)-2-prop-1-en-2-ylhexanoate (PubChem CID 10530833) has the molecular formula C32H48O6Si and a molecular weight of 556.82 g/mol. Its IUPAC name is ethyl (2S,3S,4S)-6-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4-phenylmethoxy-3-(phenylmethoxymethyl)-2-prop-1-en-2-ylhexanoate.
| Compound Name | ethyl (2S,3S,4S)-6-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4-phenylmethoxy-3-(phenylmethoxymethyl)-2-prop-1-en-2-ylhexanoate |
|---|---|
| PubChem CID | 10530833 |
| Molecular Formula | C32H48O6Si |
| Molecular Weight | 556.82 g/mol |
| Exact Mass | 556.32 |
| IUPAC Name | ethyl (2S,3S,4S)-6-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4-phenylmethoxy-3-(phenylmethoxymethyl)-2-prop-1-en-2-ylhexanoate |
| SMILES | C=C(C)[C@H](C(=O)OCC)[C@](O)(COCc1ccccc1)[C@H](CCO[Si](C)(C)C(C)(C)C)OCc1ccccc1 |
| InChI | InChI=1S/C32H48O6Si/c1-9-36-30(33)29(25(2)3)32(34,24-35-22-26-16-12-10-13-17-26)28(37-23-27-18-14-11-15-19-27)20-21-38-39(7,8)31(4,5)6/h10-19,28-29,34H,2,9,20-24H2,1,3-8H3/t28-,29+,32-/m0/s1 |
| InChIKey | VZLSLMUFXTZGKM-LBRLCBGXSA-N |
| XLogP | 6.69 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.82 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|