C27H32O5 — CID 74765974
cis-dibenzyl (3R,4S)-3-ethenyl-4-[(2-methylpropan-2-yl)oxy]cyclopentane-1,1-dicarboxylate (PubChem CID 74765974) has the molecular formula C27H32O5 and a molecular weight of 436.55 g/mol. Its IUPAC name is cis-dibenzyl (3R,4S)-3-ethenyl-4-[(2-methylpropan-2-yl)oxy]cyclopentane-1,1-dicarboxylate.
| Compound Name | cis-dibenzyl (3R,4S)-3-ethenyl-4-[(2-methylpropan-2-yl)oxy]cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 74765974 |
| Molecular Formula | C27H32O5 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | cis-dibenzyl (3R,4S)-3-ethenyl-4-[(2-methylpropan-2-yl)oxy]cyclopentane-1,1-dicarboxylate |
| SMILES | C=C[C@H]1CC(C(=O)OCc2ccccc2)(C(=O)OCc2ccccc2)C[C@@H]1OC(C)(C)C |
| InChI | InChI=1S/C27H32O5/c1-5-22-16-27(17-23(22)32-26(2,3)4,24(28)30-18-20-12-8-6-9-13-20)25(29)31-19-21-14-10-7-11-15-21/h5-15,22-23H,1,16-19H2,2-4H3/t22-,23-/m0/s1 |
| InChIKey | MYSNYRYGYPBOIM-GOTSBHOMSA-N |
| XLogP | 5.24 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|