C19H24O5 — CID 102282085
dimethyl (3S)-3-[(R)-ethoxy(phenyl)methyl]-4-methylidenecyclopentane-1,1-dicarboxylate (PubChem CID 102282085) has the molecular formula C19H24O5 and a molecular weight of 332.40 g/mol. Its IUPAC name is dimethyl (3S)-3-[(R)-ethoxy(phenyl)methyl]-4-methylidenecyclopentane-1,1-dicarboxylate.
| Compound Name | dimethyl (3S)-3-[(R)-ethoxy(phenyl)methyl]-4-methylidenecyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 102282085 |
| Molecular Formula | C19H24O5 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | dimethyl (3S)-3-[(R)-ethoxy(phenyl)methyl]-4-methylidenecyclopentane-1,1-dicarboxylate |
| SMILES | C=C1CC(C(=O)OC)(C(=O)OC)C[C@@H]1[C@@H](OCC)c1ccccc1 |
| InChI | InChI=1S/C19H24O5/c1-5-24-16(14-9-7-6-8-10-14)15-12-19(11-13(15)2,17(20)22-3)18(21)23-4/h6-10,15-16H,2,5,11-12H2,1,3-4H3/t15-,16-/m0/s1 |
| InChIKey | ODGLFBQFQQETGR-HOTGVXAUSA-N |
| XLogP | 3.06 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|