C22H30O5 — CID 56977105
4-[[(2R,3aR,4S,5S,6aS)-5-hydroxy-4-(4-phenylbutanoyl)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]oxy]butanoic acid (PubChem CID 56977105) has the molecular formula C22H30O5 and a molecular weight of 374.48 g/mol. Its IUPAC name is 4-[[(2R,3aR,4S,5S,6aS)-5-hydroxy-4-(4-phenylbutanoyl)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]oxy]butanoic acid.
| Compound Name | 4-[[(2R,3aR,4S,5S,6aS)-5-hydroxy-4-(4-phenylbutanoyl)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]oxy]butanoic acid |
|---|---|
| PubChem CID | 56977105 |
| Molecular Formula | C22H30O5 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 4-[[(2R,3aR,4S,5S,6aS)-5-hydroxy-4-(4-phenylbutanoyl)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]oxy]butanoic acid |
| SMILES | O=C(O)CCCO[C@@H]1C[C@@H]2C[C@H](O)[C@@H](C(=O)CCCc3ccccc3)[C@@H]2C1 |
| InChI | InChI=1S/C22H30O5/c23-19(9-4-8-15-6-2-1-3-7-15)22-18-14-17(12-16(18)13-20(22)24)27-11-5-10-21(25)26/h1-3,6-7,16-18,20,22,24H,4-5,8-14H2,(H,25,26)/t16-,17-,18-,20+,22-/m1/s1 |
| InChIKey | UTXRHLUIIXRGOP-LJKBXEIESA-N |
| XLogP | 3.24 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|