C25H25FN6O5 — CID 25212172
N-[[(5S)-3-[3-fluoro-4-[4-[2-oxo-2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetyl]piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 25212172) has the molecular formula C25H25FN6O5 and a molecular weight of 508.51 g/mol. Its IUPAC name is N-[[(5S)-3-[3-fluoro-4-[4-[2-oxo-2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetyl]piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-3-[3-fluoro-4-[4-[2-oxo-2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetyl]piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 25212172 |
| Molecular Formula | C25H25FN6O5 |
| Molecular Weight | 508.51 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | N-[[(5S)-3-[3-fluoro-4-[4-[2-oxo-2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetyl]piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(N3CCN(C(=O)C(=O)c4c[nH]c5ncccc45)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C25H25FN6O5/c1-15(33)28-12-17-14-32(25(36)37-17)16-4-5-21(20(26)11-16)30-7-9-31(10-8-30)24(35)22(34)19-13-29-23-18(19)3-2-6-27-23/h2-6,11,13,17H,7-10,12,14H2,1H3,(H,27,29)(H,28,33)/t17-/m0/s1 |
| InChIKey | CTGVKABJBNZZJC-KRWDZBQOSA-N |
| XLogP | 1.69 |
| TPSA | 127.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.51 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|