C26H25BrFN5O4S — CID 44579470
N-[[(5S)-3-[4-[4-[2-(5-bromo-1H-indol-3-yl)-2-oxoacetyl]piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide (PubChem CID 44579470) has the molecular formula C26H25BrFN5O4S and a molecular weight of 602.49 g/mol. Its IUPAC name is N-[[(5S)-3-[4-[4-[2-(5-bromo-1H-indol-3-yl)-2-oxoacetyl]piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide.
| Compound Name | N-[[(5S)-3-[4-[4-[2-(5-bromo-1H-indol-3-yl)-2-oxoacetyl]piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide |
|---|---|
| PubChem CID | 44579470 |
| Molecular Formula | C26H25BrFN5O4S |
| Molecular Weight | 602.49 g/mol |
| Exact Mass | 601.08 |
| IUPAC Name | N-[[(5S)-3-[4-[4-[2-(5-bromo-1H-indol-3-yl)-2-oxoacetyl]piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide |
| SMILES | CC(=S)NC[C@H]1CN(c2ccc(N3CCN(C(=O)C(=O)c4c[nH]c5ccc(Br)cc45)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C26H25BrFN5O4S/c1-15(38)29-12-18-14-33(26(36)37-18)17-3-5-23(21(28)11-17)31-6-8-32(9-7-31)25(35)24(34)20-13-30-22-4-2-16(27)10-19(20)22/h2-5,10-11,13,18,30H,6-9,12,14H2,1H3,(H,29,38)/t18-/m0/s1 |
| InChIKey | GRKBEHVXUDYVNF-SFHVURJKSA-N |
| XLogP | 3.86 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|