C20H18NO3P — CID 25212434
5-[ethyl(methoxy)phosphoryl]-2-naphthalen-2-yl-1,3-benzoxazole (PubChem CID 25212434) has the molecular formula C20H18NO3P and a molecular weight of 351.34 g/mol. Its IUPAC name is 5-[ethyl(methoxy)phosphoryl]-2-naphthalen-2-yl-1,3-benzoxazole.
| Compound Name | 5-[ethyl(methoxy)phosphoryl]-2-naphthalen-2-yl-1,3-benzoxazole |
|---|---|
| PubChem CID | 25212434 |
| Molecular Formula | C20H18NO3P |
| Molecular Weight | 351.34 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 5-[ethyl(methoxy)phosphoryl]-2-naphthalen-2-yl-1,3-benzoxazole |
| SMILES | CCP(=O)(OC)c1ccc2oc(-c3ccc4ccccc4c3)nc2c1 |
| InChI | InChI=1S/C20H18NO3P/c1-3-25(22,23-2)17-10-11-19-18(13-17)21-20(24-19)16-9-8-14-6-4-5-7-15(14)12-16/h4-13H,3H2,1-2H3 |
| InChIKey | GPAGWSVBQUHVII-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.34 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|