C16H27O5P — CID 25213378
(3S,6aS)-4-diethoxyphosphoryl-3-pentyl-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one (PubChem CID 25213378) has the molecular formula C16H27O5P and a molecular weight of 330.36 g/mol. Its IUPAC name is (3S,6aS)-4-diethoxyphosphoryl-3-pentyl-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one.
| Compound Name | (3S,6aS)-4-diethoxyphosphoryl-3-pentyl-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one |
|---|---|
| PubChem CID | 25213378 |
| Molecular Formula | C16H27O5P |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | (3S,6aS)-4-diethoxyphosphoryl-3-pentyl-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one |
| SMILES | CCCCC[C@@H]1OC[C@H]2CC(=O)C(P(=O)(OCC)OCC)=C21 |
| InChI | InChI=1S/C16H27O5P/c1-4-7-8-9-14-15-12(11-19-14)10-13(17)16(15)22(18,20-5-2)21-6-3/h12,14H,4-11H2,1-3H3/t12-,14+/m1/s1 |
| InChIKey | DAHLUBLTIJCKTA-OCCSQVGLSA-N |
| XLogP | 4.07 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|