C21H25ClN2O3 — CID 25214274
2-[2-[4-[(4-chloro-2,3,5,6-tetradeuteriophenyl)-deuterio-(2,3,4,5,6-pentadeuteriophenyl)methyl]-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl]-1,1,2,2-tetradeuterioethoxy]acetic acid (PubChem CID 25214274) has the molecular formula C21H25ClN2O3 and a molecular weight of 411.03 g/mol. Its IUPAC name is 2-[2-[4-[(4-chloro-2,3,5,6-tetradeuteriophenyl)-deuterio-(2,3,4,5,6-pentadeuteriophenyl)methyl]-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl]-1,1,2,2-tetradeuterioethoxy]acetic acid.
| Compound Name | 2-[2-[4-[(4-chloro-2,3,5,6-tetradeuteriophenyl)-deuterio-(2,3,4,5,6-pentadeuteriophenyl)methyl]-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl]-1,1,2,2-tetradeuterioethoxy]acetic acid |
|---|---|
| PubChem CID | 25214274 |
| Molecular Formula | C21H25ClN2O3 |
| Molecular Weight | 411.03 g/mol |
| Exact Mass | 410.29 |
| IUPAC Name | 2-[2-[4-[(4-chloro-2,3,5,6-tetradeuteriophenyl)-deuterio-(2,3,4,5,6-pentadeuteriophenyl)methyl]-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl]-1,1,2,2-tetradeuterioethoxy]acetic acid |
| SMILES | [2H]c1c([2H])c([2H])c(C([2H])(c2c([2H])c([2H])c(Cl)c([2H])c2[2H])N2C([2H])([2H])C([2H])([2H])N(C([2H])([2H])C([2H])([2H])OCC(=O)O)C([2H])([2H])C2([2H])[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C21H25ClN2O3/c22-19-8-6-18(7-9-19)21(17-4-2-1-3-5-17)24-12-10-23(11-13-24)14-15-27-16-20(25)26/h1-9,21H,10-16H2,(H,25,26)/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D2,11D2,12D2,13D2,14D2,15D2,21D |
| InChIKey | ZKLPARSLTMPFCP-KSSPKQTDSA-N |
| XLogP | 3.15 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.03 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |