C21H25ClN2O3 — CID 25213802
deuterio 2-[2-[4-[(4-chlorophenyl)-phenylmethyl]-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl]-1,1,2,2-tetradeuterioethoxy]acetate (PubChem CID 25213802) has the molecular formula C21H25ClN2O3 and a molecular weight of 401.97 g/mol. Its IUPAC name is deuterio 2-[2-[4-[(4-chlorophenyl)-phenylmethyl]-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl]-1,1,2,2-tetradeuterioethoxy]acetate.
| Compound Name | deuterio 2-[2-[4-[(4-chlorophenyl)-phenylmethyl]-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl]-1,1,2,2-tetradeuterioethoxy]acetate |
|---|---|
| PubChem CID | 25213802 |
| Molecular Formula | C21H25ClN2O3 |
| Molecular Weight | 401.97 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | deuterio 2-[2-[4-[(4-chlorophenyl)-phenylmethyl]-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl]-1,1,2,2-tetradeuterioethoxy]acetate |
| SMILES | [2H]OC(=O)COC([2H])([2H])C([2H])([2H])N1C([2H])([2H])C([2H])([2H])N(C(c2ccccc2)c2ccc(Cl)cc2)C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C21H25ClN2O3/c22-19-8-6-18(7-9-19)21(17-4-2-1-3-5-17)24-12-10-23(11-13-24)14-15-27-16-20(25)26/h1-9,21H,10-16H2,(H,25,26)/i10D2,11D2,12D2,13D2,14D2,15D2/hD |
| InChIKey | ZKLPARSLTMPFCP-IVYMMNDJSA-N |
| XLogP | 3.15 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.97 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |