C17H19ClN2 — CID 46780996
1-[(4-chlorophenyl)-phenylmethyl]-2,2,3,3,5,5,6,6-octadeuteriopiperazine (PubChem CID 46780996) has the molecular formula C17H19ClN2 and a molecular weight of 294.85 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)-phenylmethyl]-2,2,3,3,5,5,6,6-octadeuteriopiperazine.
| Compound Name | 1-[(4-chlorophenyl)-phenylmethyl]-2,2,3,3,5,5,6,6-octadeuteriopiperazine |
|---|---|
| PubChem CID | 46780996 |
| Molecular Formula | C17H19ClN2 |
| Molecular Weight | 294.85 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 1-[(4-chlorophenyl)-phenylmethyl]-2,2,3,3,5,5,6,6-octadeuteriopiperazine |
| SMILES | [2H]C1([2H])NC([2H])([2H])C([2H])([2H])N(C(c2ccccc2)c2ccc(Cl)cc2)C1([2H])[2H] |
| InChI | InChI=1S/C17H19ClN2/c18-16-8-6-15(7-9-16)17(14-4-2-1-3-5-14)20-12-10-19-11-13-20/h1-9,17,19H,10-13H2/i10D2,11D2,12D2,13D2 |
| InChIKey | UZKBSZSTDQSMDR-BGKXKQMNSA-N |
| XLogP | 3.33 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.85 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |