C18H21ClN2 — CID 46198782
1-[(4-chlorophenyl)-deuterio-phenylmethyl]-2,2,3,3,5,5,6,6-octadeuterio-4-(trideuteriomethyl)piperazine (PubChem CID 46198782) has the molecular formula C18H21ClN2 and a molecular weight of 312.91 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)-deuterio-phenylmethyl]-2,2,3,3,5,5,6,6-octadeuterio-4-(trideuteriomethyl)piperazine.
| Compound Name | 1-[(4-chlorophenyl)-deuterio-phenylmethyl]-2,2,3,3,5,5,6,6-octadeuterio-4-(trideuteriomethyl)piperazine |
|---|---|
| PubChem CID | 46198782 |
| Molecular Formula | C18H21ClN2 |
| Molecular Weight | 312.91 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | 1-[(4-chlorophenyl)-deuterio-phenylmethyl]-2,2,3,3,5,5,6,6-octadeuterio-4-(trideuteriomethyl)piperazine |
| SMILES | [2H]C([2H])([2H])N1C([2H])([2H])C([2H])([2H])N(C([2H])(c2ccccc2)c2ccc(Cl)cc2)C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C18H21ClN2/c1-20-11-13-21(14-12-20)18(15-5-3-2-4-6-15)16-7-9-17(19)10-8-16/h2-10,18H,11-14H2,1H3/i1D3,11D2,12D2,13D2,14D2,18D |
| InChIKey | WFNAKBGANONZEQ-VWTNRLEDSA-N |
| XLogP | 3.68 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.91 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |