C17H12N4O2 — CID 25214989
N-[8-(furan-3-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]benzamide (PubChem CID 25214989) has the molecular formula C17H12N4O2 and a molecular weight of 304.31 g/mol. Its IUPAC name is N-[8-(furan-3-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]benzamide.
| Compound Name | N-[8-(furan-3-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]benzamide |
|---|---|
| PubChem CID | 25214989 |
| Molecular Formula | C17H12N4O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | N-[8-(furan-3-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]benzamide |
| SMILES | O=C(Nc1nc2c(-c3ccoc3)cccn2n1)c1ccccc1 |
| InChI | InChI=1S/C17H12N4O2/c22-16(12-5-2-1-3-6-12)19-17-18-15-14(13-8-10-23-11-13)7-4-9-21(15)20-17/h1-11H,(H,19,20,22) |
| InChIKey | LNHWUHLTCJHTJH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 72.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |