C11H9Br2ClN2O — CID 25215098
4,5-dibromo-2-chloro-1-(phenylmethoxymethyl)imidazole (PubChem CID 25215098) has the molecular formula C11H9Br2ClN2O and a molecular weight of 380.47 g/mol. Its IUPAC name is 4,5-dibromo-2-chloro-1-(phenylmethoxymethyl)imidazole.
| Compound Name | 4,5-dibromo-2-chloro-1-(phenylmethoxymethyl)imidazole |
|---|---|
| PubChem CID | 25215098 |
| Molecular Formula | C11H9Br2ClN2O |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 377.88 |
| IUPAC Name | 4,5-dibromo-2-chloro-1-(phenylmethoxymethyl)imidazole |
| SMILES | Clc1nc(Br)c(Br)n1COCc1ccccc1 |
| InChI | InChI=1S/C11H9Br2ClN2O/c12-9-10(13)16(11(14)15-9)7-17-6-8-4-2-1-3-5-8/h1-5H,6-7H2 |
| InChIKey | YRKKZMRDZFGHMJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |