About 5-chloro-1,6-bis(phenylmethoxymethyl)pyrimidine-2,4-dione
5-chloro-1,6-bis(phenylmethoxymethyl)pyrimidine-2,4-dione (PubChem CID 127047090) has the molecular formula C20H19ClN2O4
and a molecular weight of 386.83 g/mol. Its IUPAC name is 5-chloro-1,6-bis(phenylmethoxymethyl)pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 5-chloro-1,6-bis(phenylmethoxymethyl)pyrimidine-2,4-dione |
| PubChem CID | 127047090 |
| Molecular Formula | C20H19ClN2O4 |
| Molecular Weight | 386.83 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 5-chloro-1,6-bis(phenylmethoxymethyl)pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(COCc2ccccc2)c(COCc2ccccc2)c1Cl |
| InChI | InChI=1S/C20H19ClN2O4/c21-18-17(13-26-11-15-7-3-1-4-8-15)23(20(25)22-19(18)24)14-27-12-16-9-5-2-6-10-16/h1-10H,11-14H2,(H,22,24,25) |
| InChIKey | WOKFCGATHAIAHY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.83 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-chloro-1,6-bis(phenylmethoxymethyl)pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1,6-bis(phenylmethoxymethyl)pyrimidine-2,4-dione?
The IUPAC name of 5-chloro-1,6-bis(phenylmethoxymethyl)pyrimidine-2,4-dione (CID 127047090) is 5-chloro-1,6-bis(phenylmethoxymethyl)pyrimidine-2,4-dione.
What is the SMILES notation for 5-chloro-1,6-bis(phenylmethoxymethyl)pyrimidine-2,4-dione?
The canonical SMILES for 5-chloro-1,6-bis(phenylmethoxymethyl)pyrimidine-2,4-dione is O=c1[nH]c(=O)n(COCc2ccccc2)c(COCc2ccccc2)c1Cl.
What is the InChIKey of 5-chloro-1,6-bis(phenylmethoxymethyl)pyrimidine-2,4-dione?
The InChIKey is WOKFCGATHAIAHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19ClN2O4/c21-18-17(13-26-11-15-7-3-1-4-8-15)23(20(25)22-19(18)24)14-27-12-16-9-5-2-6-10-16/h1-10H,11-14H2,(H,22,24,25).
What are the key properties of 5-chloro-1,6-bis(phenylmethoxymethyl)pyrimidine-2,4-dione?
5-chloro-1,6-bis(phenylmethoxymethyl)pyrimidine-2,4-dione has a molecular weight of 386.83 g/mol, XLogP of 3.08, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1,6-bis(phenylmethoxymethyl)pyrimidine-2,4-dione is sourced from PubChem (CID 127047090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).