C18H17N3O3 — CID 25199123
6-benzyl-2-(phenylmethoxymethyl)-1,2,4-triazine-3,5-dione (PubChem CID 25199123) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is 6-benzyl-2-(phenylmethoxymethyl)-1,2,4-triazine-3,5-dione.
| Compound Name | 6-benzyl-2-(phenylmethoxymethyl)-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 25199123 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 6-benzyl-2-(phenylmethoxymethyl)-1,2,4-triazine-3,5-dione |
| SMILES | O=c1[nH]c(=O)n(COCc2ccccc2)nc1Cc1ccccc1 |
| InChI | InChI=1S/C18H17N3O3/c22-17-16(11-14-7-3-1-4-8-14)20-21(18(23)19-17)13-24-12-15-9-5-2-6-10-15/h1-10H,11-13H2,(H,19,22,23) |
| InChIKey | URPYLJOFTHJLTF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |