C20H16N2O6 — CID 141371447
6-benzoyl-2,4-dioxo-1-(phenylmethoxymethyl)pyrimidine-5-carboxylic acid (PubChem CID 141371447) has the molecular formula C20H16N2O6 and a molecular weight of 380.36 g/mol. Its IUPAC name is 6-benzoyl-2,4-dioxo-1-(phenylmethoxymethyl)pyrimidine-5-carboxylic acid.
| Compound Name | 6-benzoyl-2,4-dioxo-1-(phenylmethoxymethyl)pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 141371447 |
| Molecular Formula | C20H16N2O6 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 6-benzoyl-2,4-dioxo-1-(phenylmethoxymethyl)pyrimidine-5-carboxylic acid |
| SMILES | O=C(O)c1c(C(=O)c2ccccc2)n(COCc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H16N2O6/c23-17(14-9-5-2-6-10-14)16-15(19(25)26)18(24)21-20(27)22(16)12-28-11-13-7-3-1-4-8-13/h1-10H,11-12H2,(H,25,26)(H,21,24,27) |
| InChIKey | NFWPBFYCEGXCBW-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 118.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |