C12H11FN2O3 — CID 139330532
5-fluoro-3-(phenylmethoxymethyl)-1H-pyrimidine-2,4-dione (PubChem CID 139330532) has the molecular formula C12H11FN2O3 and a molecular weight of 250.23 g/mol. Its IUPAC name is 5-fluoro-3-(phenylmethoxymethyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 5-fluoro-3-(phenylmethoxymethyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 139330532 |
| Molecular Formula | C12H11FN2O3 |
| Molecular Weight | 250.23 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 5-fluoro-3-(phenylmethoxymethyl)-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]cc(F)c(=O)n1COCc1ccccc1 |
| InChI | InChI=1S/C12H11FN2O3/c13-10-6-14-12(17)15(11(10)16)8-18-7-9-4-2-1-3-5-9/h1-6H,7-8H2,(H,14,17) |
| InChIKey | MZXIEKVYZOUKMB-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.23 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |