C25H32O6 — CID 25216963
1-[(17R)-2-ethoxy-17-hydroxy-10,13-dimethyl-3-oxo-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-hydroxybutane-1,3-dione (PubChem CID 25216963) has the molecular formula C25H32O6 and a molecular weight of 428.53 g/mol. Its IUPAC name is 1-[(17R)-2-ethoxy-17-hydroxy-10,13-dimethyl-3-oxo-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-hydroxybutane-1,3-dione.
| Compound Name | 1-[(17R)-2-ethoxy-17-hydroxy-10,13-dimethyl-3-oxo-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-hydroxybutane-1,3-dione |
|---|---|
| PubChem CID | 25216963 |
| Molecular Formula | C25H32O6 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 1-[(17R)-2-ethoxy-17-hydroxy-10,13-dimethyl-3-oxo-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-hydroxybutane-1,3-dione |
| SMILES | CCOC1=CC2(C)C(=CC1=O)CCC1C2=CCC2(C)C1CC[C@]2(O)C(=O)C(O)C(C)=O |
| InChI | InChI=1S/C25H32O6/c1-5-31-20-13-23(3)15(12-19(20)27)6-7-16-17(23)8-10-24(4)18(16)9-11-25(24,30)22(29)21(28)14(2)26/h8,12-13,16,18,21,28,30H,5-7,9-11H2,1-4H3/t16?,18?,21?,23?,24?,25-/m0/s1 |
| InChIKey | SCSNCSKTTXUBNP-FNKSTCFBSA-N |
| XLogP | 2.83 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|