C22H28O3 — CID 57264087
(8S,10S,13S,14S)-17-(2,2-dihydroxyethylidene)-2,10,13-trimethyl-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-3-one (PubChem CID 57264087) has the molecular formula C22H28O3 and a molecular weight of 340.46 g/mol. Its IUPAC name is (8S,10S,13S,14S)-17-(2,2-dihydroxyethylidene)-2,10,13-trimethyl-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,10S,13S,14S)-17-(2,2-dihydroxyethylidene)-2,10,13-trimethyl-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 57264087 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | (8S,10S,13S,14S)-17-(2,2-dihydroxyethylidene)-2,10,13-trimethyl-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC1=C[C@@]2(C)C(=CC1=O)CC[C@@H]1C2=CC[C@]2(C)C(=CC(O)O)CC[C@@H]12 |
| InChI | InChI=1S/C22H28O3/c1-13-12-22(3)14(10-19(13)23)4-6-16-17-7-5-15(11-20(24)25)21(17,2)9-8-18(16)22/h8,10-12,16-17,20,24-25H,4-7,9H2,1-3H3/t16-,17-,21+,22-/m0/s1 |
| InChIKey | NOWIPCYLQWBWSU-QPAOKJHLSA-N |
| XLogP | 3.84 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|