C15H16ClN3O — CID 25218348
3-chloro-N-[(3,5,6-trimethylpyrazin-2-yl)methyl]benzamide (PubChem CID 25218348) has the molecular formula C15H16ClN3O and a molecular weight of 289.77 g/mol. Its IUPAC name is 3-chloro-N-[(3,5,6-trimethylpyrazin-2-yl)methyl]benzamide.
| Compound Name | 3-chloro-N-[(3,5,6-trimethylpyrazin-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 25218348 |
| Molecular Formula | C15H16ClN3O |
| Molecular Weight | 289.77 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 3-chloro-N-[(3,5,6-trimethylpyrazin-2-yl)methyl]benzamide |
| SMILES | Cc1nc(C)c(CNC(=O)c2cccc(Cl)c2)nc1C |
| InChI | InChI=1S/C15H16ClN3O/c1-9-10(2)19-14(11(3)18-9)8-17-15(20)12-5-4-6-13(16)7-12/h4-7H,8H2,1-3H3,(H,17,20) |
| InChIKey | SUVQTGPJIYDECA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.77 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |