C25H23N5O4 — CID 25221621
10-(3-hydroxyphenyl)-13-(2-imidazol-1-ylethyl)-4-methoxy-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione (PubChem CID 25221621) has the molecular formula C25H23N5O4 and a molecular weight of 457.49 g/mol. Its IUPAC name is 10-(3-hydroxyphenyl)-13-(2-imidazol-1-ylethyl)-4-methoxy-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione.
| Compound Name | 10-(3-hydroxyphenyl)-13-(2-imidazol-1-ylethyl)-4-methoxy-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione |
|---|---|
| PubChem CID | 25221621 |
| Molecular Formula | C25H23N5O4 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 10-(3-hydroxyphenyl)-13-(2-imidazol-1-ylethyl)-4-methoxy-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione |
| SMILES | COc1ccc2[nH]c3c(c2c1)CC1C(=O)N(CCn2ccnc2)C(=O)N1C3c1cccc(O)c1 |
| InChI | InChI=1S/C25H23N5O4/c1-34-17-5-6-20-18(12-17)19-13-21-24(32)29(10-9-28-8-7-26-14-28)25(33)30(21)23(22(19)27-20)15-3-2-4-16(31)11-15/h2-8,11-12,14,21,23,27,31H,9-10,13H2,1H3 |
| InChIKey | YALUVUQQYAIJQR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 103.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|