C29H32F2N4O3 — CID 25222272
methyl 6-[[(E)-3-(2,5-difluorophenyl)prop-2-enyl]amino]-2-(6-methoxy-1,5-naphthyridin-4-yl)-1,3,4,4a,5,6,7,8-octahydroisoquinoline-8a-carboxylate (PubChem CID 25222272) has the molecular formula C29H32F2N4O3 and a molecular weight of 522.60 g/mol. Its IUPAC name is methyl 6-[[(E)-3-(2,5-difluorophenyl)prop-2-enyl]amino]-2-(6-methoxy-1,5-naphthyridin-4-yl)-1,3,4,4a,5,6,7,8-octahydroisoquinoline-8a-carboxylate.
| Compound Name | methyl 6-[[(E)-3-(2,5-difluorophenyl)prop-2-enyl]amino]-2-(6-methoxy-1,5-naphthyridin-4-yl)-1,3,4,4a,5,6,7,8-octahydroisoquinoline-8a-carboxylate |
|---|---|
| PubChem CID | 25222272 |
| Molecular Formula | C29H32F2N4O3 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.24 |
| IUPAC Name | methyl 6-[[(E)-3-(2,5-difluorophenyl)prop-2-enyl]amino]-2-(6-methoxy-1,5-naphthyridin-4-yl)-1,3,4,4a,5,6,7,8-octahydroisoquinoline-8a-carboxylate |
| SMILES | COC(=O)C12CCC(NC/C=C/c3cc(F)ccc3F)CC1CCN(c1ccnc3ccc(OC)nc13)C2 |
| InChI | InChI=1S/C29H32F2N4O3/c1-37-26-8-7-24-27(34-26)25(10-14-33-24)35-15-11-20-17-22(9-12-29(20,18-35)28(36)38-2)32-13-3-4-19-16-21(30)5-6-23(19)31/h3-8,10,14,16,20,22,32H,9,11-13,15,17-18H2,1-2H3/b4-3+ |
| InChIKey | LXYAOZLMWHWOJX-ONEGZZNKSA-N |
| XLogP | 4.76 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |