C23H23ClN2O5 — CID 25222899
6-chloro-N-(2-phenoxyethyl)-2-(3,4,5-trimethoxyphenyl)pyridine-3-carboxamide (PubChem CID 25222899) has the molecular formula C23H23ClN2O5 and a molecular weight of 442.90 g/mol. Its IUPAC name is 6-chloro-N-(2-phenoxyethyl)-2-(3,4,5-trimethoxyphenyl)pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-(2-phenoxyethyl)-2-(3,4,5-trimethoxyphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 25222899 |
| Molecular Formula | C23H23ClN2O5 |
| Molecular Weight | 442.90 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 6-chloro-N-(2-phenoxyethyl)-2-(3,4,5-trimethoxyphenyl)pyridine-3-carboxamide |
| SMILES | COc1cc(-c2nc(Cl)ccc2C(=O)NCCOc2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C23H23ClN2O5/c1-28-18-13-15(14-19(29-2)22(18)30-3)21-17(9-10-20(24)26-21)23(27)25-11-12-31-16-7-5-4-6-8-16/h4-10,13-14H,11-12H2,1-3H3,(H,25,27) |
| InChIKey | UQZMWBOTCXKYNS-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.90 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|