C23H29NO6 — CID 25229163
1-O-tert-butyl 2-O-methyl (2S,5R)-2-ethenyl-5-[(E)-2-(4-methoxycarbonylphenyl)ethenyl]pyrrolidine-1,2-dicarboxylate (PubChem CID 25229163) has the molecular formula C23H29NO6 and a molecular weight of 415.49 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S,5R)-2-ethenyl-5-[(E)-2-(4-methoxycarbonylphenyl)ethenyl]pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S,5R)-2-ethenyl-5-[(E)-2-(4-methoxycarbonylphenyl)ethenyl]pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 25229163 |
| Molecular Formula | C23H29NO6 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,5R)-2-ethenyl-5-[(E)-2-(4-methoxycarbonylphenyl)ethenyl]pyrrolidine-1,2-dicarboxylate |
| SMILES | C=C[C@]1(C(=O)OC)CC[C@H](/C=C/c2ccc(C(=O)OC)cc2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H29NO6/c1-7-23(20(26)29-6)15-14-18(24(23)21(27)30-22(2,3)4)13-10-16-8-11-17(12-9-16)19(25)28-5/h7-13,18H,1,14-15H2,2-6H3/b13-10+/t18-,23+/m0/s1 |
| InChIKey | BDKNKEITAGCEIE-WLRCJQIBSA-N |
| XLogP | 3.98 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|