C36H46N2O5 — CID 25231808
methyl 6-[[[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]-methylcarbamoyl]amino]hexanoate (PubChem CID 25231808) has the molecular formula C36H46N2O5 and a molecular weight of 586.77 g/mol. Its IUPAC name is methyl 6-[[[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]-methylcarbamoyl]amino]hexanoate.
| Compound Name | methyl 6-[[[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]-methylcarbamoyl]amino]hexanoate |
|---|---|
| PubChem CID | 25231808 |
| Molecular Formula | C36H46N2O5 |
| Molecular Weight | 586.77 g/mol |
| Exact Mass | 586.34 |
| IUPAC Name | methyl 6-[[[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]-methylcarbamoyl]amino]hexanoate |
| SMILES | CC#C[C@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CCC4=C3[C@@H](c3ccc(N(C)C(=O)NCCCCCC(=O)OC)cc3)C[C@@]21C |
| InChI | InChI=1S/C36H46N2O5/c1-5-19-36(42)20-18-31-29-16-12-25-22-27(39)15-17-28(25)33(29)30(23-35(31,36)2)24-10-13-26(14-11-24)38(3)34(41)37-21-8-6-7-9-32(40)43-4/h10-11,13-14,22,29-31,42H,6-9,12,15-18,20-21,23H2,1-4H3,(H,37,41)/t29-,30+,31-,35-,36-/m0/s1 |
| InChIKey | QQBNYAUHNSUDCD-CGWUTTPTSA-N |
| XLogP | 6.22 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.77 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|