C18H13NO3S2 — CID 25232374
3-(1,3-benzothiazol-2-ylsulfanylmethyl)-8-methoxychromen-2-one (PubChem CID 25232374) has the molecular formula C18H13NO3S2 and a molecular weight of 355.44 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-ylsulfanylmethyl)-8-methoxychromen-2-one.
| Compound Name | 3-(1,3-benzothiazol-2-ylsulfanylmethyl)-8-methoxychromen-2-one |
|---|---|
| PubChem CID | 25232374 |
| Molecular Formula | C18H13NO3S2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | 3-(1,3-benzothiazol-2-ylsulfanylmethyl)-8-methoxychromen-2-one |
| SMILES | COc1cccc2cc(CSc3nc4ccccc4s3)c(=O)oc12 |
| InChI | InChI=1S/C18H13NO3S2/c1-21-14-7-4-5-11-9-12(17(20)22-16(11)14)10-23-18-19-13-6-2-3-8-15(13)24-18/h2-9H,10H2,1H3 |
| InChIKey | MHKDWAFIBBTBNF-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|