C19H25NO3 — CID 25232470
N-benzyl-N-[(1S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl]but-3-enamide (PubChem CID 25232470) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is N-benzyl-N-[(1S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl]but-3-enamide.
| Compound Name | N-benzyl-N-[(1S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl]but-3-enamide |
|---|---|
| PubChem CID | 25232470 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | N-benzyl-N-[(1S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl]but-3-enamide |
| SMILES | C=CCC(=O)N(Cc1ccccc1)[C@@H](C=C)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C19H25NO3/c1-5-10-18(21)20(13-15-11-8-7-9-12-15)16(6-2)17-14-22-19(3,4)23-17/h5-9,11-12,16-17H,1-2,10,13-14H2,3-4H3/t16-,17+/m0/s1 |
| InChIKey | QGBKHNRLCYFENQ-DLBZAZTESA-N |
| XLogP | 3.30 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|