C33H40FN5O7 — CID 25234696
benzyl (E,4S)-7-amino-4-[[(2S)-3-(4-fluorophenyl)-2-[[(2R)-3-methyl-2-[(5-methyl-2,3-dihydro-1,2-oxazole-3-carbonyl)amino]butanoyl]amino]propanoyl]amino]-7-oxohept-2-enoate (PubChem CID 25234696) has the molecular formula C33H40FN5O7 and a molecular weight of 637.71 g/mol. Its IUPAC name is benzyl (E,4S)-7-amino-4-[[(2S)-3-(4-fluorophenyl)-2-[[(2R)-3-methyl-2-[(5-methyl-2,3-dihydro-1,2-oxazole-3-carbonyl)amino]butanoyl]amino]propanoyl]amino]-7-oxohept-2-enoate.
| Compound Name | benzyl (E,4S)-7-amino-4-[[(2S)-3-(4-fluorophenyl)-2-[[(2R)-3-methyl-2-[(5-methyl-2,3-dihydro-1,2-oxazole-3-carbonyl)amino]butanoyl]amino]propanoyl]amino]-7-oxohept-2-enoate |
|---|---|
| PubChem CID | 25234696 |
| Molecular Formula | C33H40FN5O7 |
| Molecular Weight | 637.71 g/mol |
| Exact Mass | 637.29 |
| IUPAC Name | benzyl (E,4S)-7-amino-4-[[(2S)-3-(4-fluorophenyl)-2-[[(2R)-3-methyl-2-[(5-methyl-2,3-dihydro-1,2-oxazole-3-carbonyl)amino]butanoyl]amino]propanoyl]amino]-7-oxohept-2-enoate |
| SMILES | CC1=CC(C(=O)N[C@@H](C(=O)N[C@@H](Cc2ccc(F)cc2)C(=O)N[C@H](/C=C/C(=O)OCc2ccccc2)CCC(N)=O)C(C)C)NO1 |
| InChI | InChI=1S/C33H40FN5O7/c1-20(2)30(38-32(43)27-17-21(3)46-39-27)33(44)37-26(18-22-9-11-24(34)12-10-22)31(42)36-25(13-15-28(35)40)14-16-29(41)45-19-23-7-5-4-6-8-23/h4-12,14,16-17,20,25-27,30,39H,13,15,18-19H2,1-3H3,(H2,35,40)(H,36,42)(H,37,44)(H,38,43)/b16-14+/t25-,26-,27?,30+/m0/s1 |
| InChIKey | WNDJIPBQMVZJPN-JSQWKHSQSA-N |
| XLogP | 1.85 |
| TPSA | 177.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.71 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|