C4H7NO4 — CID 25241352
(2S,3S)-2-amino-2,3-dideuteriobutanedioic acid (PubChem CID 25241352) has the molecular formula C4H7NO4 and a molecular weight of 135.12 g/mol. Its IUPAC name is (2S,3S)-2-amino-2,3-dideuteriobutanedioic acid.
| Compound Name | (2S,3S)-2-amino-2,3-dideuteriobutanedioic acid |
|---|---|
| PubChem CID | 25241352 |
| Molecular Formula | C4H7NO4 |
| Molecular Weight | 135.12 g/mol |
| Exact Mass | 135.05 |
| IUPAC Name | (2S,3S)-2-amino-2,3-dideuteriobutanedioic acid |
| SMILES | [2H][C@H](C(=O)O)[C@]([2H])(N)C(=O)O |
| InChI | InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/t2-/m0/s1/i1D,2D/t1-,2- |
| InChIKey | CKLJMWTZIZZHCS-MVPYEHFYSA-N |
| XLogP | -1.13 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.12 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |