(2S,3S)-2-amino-2,3-dideuteriobutanedioic acid

C4H7NO4 — CID 25241352

IUPAC(2S,3S)-2-amino-2,3-dideuteriobutanedioic acid
SMILES[2H][C@H](C(=O)O)[C@]([2H])(N)C(=O)O
InChIInChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/t2-/m0/s1/i1D,2D/t1-,2-
InChIKeyCKLJMWTZIZZHCS-MVPYEHFYSA-N
MW135.12 g/mol
LogP-1.13
Rot. Bonds3

About (2S,3S)-2-amino-2,3-dideuteriobutanedioic acid

(2S,3S)-2-amino-2,3-dideuteriobutanedioic acid (PubChem CID 25241352) has the molecular formula C4H7NO4 and a molecular weight of 135.12 g/mol. Its IUPAC name is (2S,3S)-2-amino-2,3-dideuteriobutanedioic acid.

Molecular Properties

Compound Name(2S,3S)-2-amino-2,3-dideuteriobutanedioic acid
PubChem CID25241352
Molecular FormulaC4H7NO4
Molecular Weight135.12 g/mol
Exact Mass135.05
IUPAC Name(2S,3S)-2-amino-2,3-dideuteriobutanedioic acid
SMILES[2H][C@H](C(=O)O)[C@]([2H])(N)C(=O)O
InChIInChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/t2-/m0/s1/i1D,2D/t1-,2-
InChIKeyCKLJMWTZIZZHCS-MVPYEHFYSA-N
XLogP-1.13
TPSA100.62 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500135.12
LogP ≤ 5-1.13
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze (2S,3S)-2-amino-2,3-dideuteriobutanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S,3S)-2-amino-2,3-dideuteriobutanedioic acid?
The IUPAC name of (2S,3S)-2-amino-2,3-dideuteriobutanedioic acid (CID 25241352) is (2S,3S)-2-amino-2,3-dideuteriobutanedioic acid.
What is the SMILES notation for (2S,3S)-2-amino-2,3-dideuteriobutanedioic acid?
The canonical SMILES for (2S,3S)-2-amino-2,3-dideuteriobutanedioic acid is [2H][C@H](C(=O)O)[C@]([2H])(N)C(=O)O.
What is the InChIKey of (2S,3S)-2-amino-2,3-dideuteriobutanedioic acid?
The InChIKey is CKLJMWTZIZZHCS-MVPYEHFYSA-N. The full InChI is InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/t2-/m0/s1/i1D,2D/t1-,2-.
What are the key properties of (2S,3S)-2-amino-2,3-dideuteriobutanedioic acid?
(2S,3S)-2-amino-2,3-dideuteriobutanedioic acid has a molecular weight of 135.12 g/mol, XLogP of -1.13, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-2-amino-2,3-dideuteriobutanedioic acid is sourced from PubChem (CID 25241352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).