C5H12N2O2 — CID 162343667
(2S)-2,5-diamino-2,3,3,4,4,5,5-heptadeuteriopentanoic acid (PubChem CID 162343667) has the molecular formula C5H12N2O2 and a molecular weight of 139.21 g/mol. Its IUPAC name is (2S)-2,5-diamino-2,3,3,4,4,5,5-heptadeuteriopentanoic acid.
| Compound Name | (2S)-2,5-diamino-2,3,3,4,4,5,5-heptadeuteriopentanoic acid |
|---|---|
| PubChem CID | 162343667 |
| Molecular Formula | C5H12N2O2 |
| Molecular Weight | 139.21 g/mol |
| Exact Mass | 139.13 |
| IUPAC Name | (2S)-2,5-diamino-2,3,3,4,4,5,5-heptadeuteriopentanoic acid |
| SMILES | [2H]C([2H])(N)C([2H])([2H])C([2H])([2H])[C@]([2H])(N)C(=O)O |
| InChI | InChI=1S/C5H12N2O2/c6-3-1-2-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9)/t4-/m0/s1/i1D2,2D2,3D2,4D |
| InChIKey | AHLPHDHHMVZTML-BFEYZEMLSA-N |
| XLogP | -0.86 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.21 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |