(2S)-2,5-diamino-2,3,3,4,4,5,5-heptadeuteriopentanoic acid

C5H12N2O2 — CID 162343667

IUPAC(2S)-2,5-diamino-2,3,3,4,4,5,5-heptadeuteriopentanoic acid
SMILES[2H]C([2H])(N)C([2H])([2H])C([2H])([2H])[C@]([2H])(N)C(=O)O
InChIInChI=1S/C5H12N2O2/c6-3-1-2-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9)/t4-/m0/s1/i1D2,2D2,3D2,4D
InChIKeyAHLPHDHHMVZTML-BFEYZEMLSA-N
MW139.21 g/mol
LogP-0.86
Rot. Bonds4

About (2S)-2,5-diamino-2,3,3,4,4,5,5-heptadeuteriopentanoic acid

(2S)-2,5-diamino-2,3,3,4,4,5,5-heptadeuteriopentanoic acid (PubChem CID 162343667) has the molecular formula C5H12N2O2 and a molecular weight of 139.21 g/mol. Its IUPAC name is (2S)-2,5-diamino-2,3,3,4,4,5,5-heptadeuteriopentanoic acid.

Molecular Properties

Compound Name(2S)-2,5-diamino-2,3,3,4,4,5,5-heptadeuteriopentanoic acid
PubChem CID162343667
Molecular FormulaC5H12N2O2
Molecular Weight139.21 g/mol
Exact Mass139.13
IUPAC Name(2S)-2,5-diamino-2,3,3,4,4,5,5-heptadeuteriopentanoic acid
SMILES[2H]C([2H])(N)C([2H])([2H])C([2H])([2H])[C@]([2H])(N)C(=O)O
InChIInChI=1S/C5H12N2O2/c6-3-1-2-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9)/t4-/m0/s1/i1D2,2D2,3D2,4D
InChIKeyAHLPHDHHMVZTML-BFEYZEMLSA-N
XLogP-0.86
TPSA89.34 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500139.21
LogP ≤ 5-0.86
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze (2S)-2,5-diamino-2,3,3,4,4,5,5-heptadeuteriopentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2,5-diamino-2,3,3,4,4,5,5-heptadeuteriopentanoic acid?
The IUPAC name of (2S)-2,5-diamino-2,3,3,4,4,5,5-heptadeuteriopentanoic acid (CID 162343667) is (2S)-2,5-diamino-2,3,3,4,4,5,5-heptadeuteriopentanoic acid.
What is the SMILES notation for (2S)-2,5-diamino-2,3,3,4,4,5,5-heptadeuteriopentanoic acid?
The canonical SMILES for (2S)-2,5-diamino-2,3,3,4,4,5,5-heptadeuteriopentanoic acid is [2H]C([2H])(N)C([2H])([2H])C([2H])([2H])[C@]([2H])(N)C(=O)O.
What is the InChIKey of (2S)-2,5-diamino-2,3,3,4,4,5,5-heptadeuteriopentanoic acid?
The InChIKey is AHLPHDHHMVZTML-BFEYZEMLSA-N. The full InChI is InChI=1S/C5H12N2O2/c6-3-1-2-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9)/t4-/m0/s1/i1D2,2D2,3D2,4D.
What are the key properties of (2S)-2,5-diamino-2,3,3,4,4,5,5-heptadeuteriopentanoic acid?
(2S)-2,5-diamino-2,3,3,4,4,5,5-heptadeuteriopentanoic acid has a molecular weight of 139.21 g/mol, XLogP of -0.86, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,5-diamino-2,3,3,4,4,5,5-heptadeuteriopentanoic acid is sourced from PubChem (CID 162343667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).