C17H16N2O3 — CID 91238594
2,5-diamino-2,3,3,4,4-pentadeuterio-5-oxopentanoic acid;dodeca-2,4,6,8,10-pentayne (PubChem CID 91238594) has the molecular formula C17H16N2O3 and a molecular weight of 301.36 g/mol. Its IUPAC name is 2,5-diamino-2,3,3,4,4-pentadeuterio-5-oxopentanoic acid;dodeca-2,4,6,8,10-pentayne.
| Compound Name | 2,5-diamino-2,3,3,4,4-pentadeuterio-5-oxopentanoic acid;dodeca-2,4,6,8,10-pentayne |
|---|---|
| PubChem CID | 91238594 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 2,5-diamino-2,3,3,4,4-pentadeuterio-5-oxopentanoic acid;dodeca-2,4,6,8,10-pentayne |
| SMILES | CC#CC#CC#CC#CC#CC.[2H]C([2H])(C(N)=O)C([2H])([2H])C([2H])(N)C(=O)O |
| InChI | InChI=1S/C12H6.C5H10N2O3/c1-3-5-7-9-11-12-10-8-6-4-2;6-3(5(9)10)1-2-4(7)8/h1-2H3;3H,1-2,6H2,(H2,7,8)(H,9,10)/i;1D2,2D2,3D |
| InChIKey | XMSXSOFGTSYJGR-HRLYDTNGSA-N |
| XLogP | -0.29 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|