C9H11NO2 — CID 135899988
(2R,3R)-2-amino-2,3-dideuterio-3-phenylpropanoic acid (PubChem CID 135899988) has the molecular formula C9H11NO2 and a molecular weight of 167.20 g/mol. Its IUPAC name is (2R,3R)-2-amino-2,3-dideuterio-3-phenylpropanoic acid.
| Compound Name | (2R,3R)-2-amino-2,3-dideuterio-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 135899988 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 167.20 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | (2R,3R)-2-amino-2,3-dideuterio-3-phenylpropanoic acid |
| SMILES | [2H][C@H](c1ccccc1)[C@@]([2H])(N)C(=O)O |
| InChI | InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m1/s1/i6D,8D/t6-,8- |
| InChIKey | COLNVLDHVKWLRT-HIKWZPMTSA-N |
| XLogP | 0.64 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.20 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |