C12H15NO3 — CID 11368070
methyl (2S,3R)-2-acetamido-2,3-dideuterio-3-phenylpropanoate (PubChem CID 11368070) has the molecular formula C12H15NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is methyl (2S,3R)-2-acetamido-2,3-dideuterio-3-phenylpropanoate.
| Compound Name | methyl (2S,3R)-2-acetamido-2,3-dideuterio-3-phenylpropanoate |
|---|---|
| PubChem CID | 11368070 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | methyl (2S,3R)-2-acetamido-2,3-dideuterio-3-phenylpropanoate |
| SMILES | [2H][C@H](c1ccccc1)[C@]([2H])(NC(C)=O)C(=O)OC |
| InChI | InChI=1S/C12H15NO3/c1-9(14)13-11(12(15)16-2)8-10-6-4-3-5-7-10/h3-7,11H,8H2,1-2H3,(H,13,14)/t11-/m0/s1/i8D,11D/t8-,11+/m1 |
| InChIKey | IKGHIFGXPVLPFD-PDMUGLPMSA-N |
| XLogP | 0.91 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |