About [ditert-butyl(phenoxy)-λ5-phosphanylidene]cyanamide
[ditert-butyl(phenoxy)-λ5-phosphanylidene]cyanamide (PubChem CID 25242129) has the molecular formula C15H23N2OP
and a molecular weight of 278.34 g/mol. Its IUPAC name is [ditert-butyl(phenoxy)-λ5-phosphanylidene]cyanamide.
Molecular Properties
| Compound Name | [ditert-butyl(phenoxy)-λ5-phosphanylidene]cyanamide |
| PubChem CID | 25242129 |
| Molecular Formula | C15H23N2OP |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | [ditert-butyl(phenoxy)-λ5-phosphanylidene]cyanamide |
| SMILES | CC(C)(C)P(=NC#N)(Oc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C15H23N2OP/c1-14(2,3)19(17-12-16,15(4,5)6)18-13-10-8-7-9-11-13/h7-11H,1-6H3 |
| InChIKey | YOJGMBFANNFKNS-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 45.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [ditert-butyl(phenoxy)-λ5-phosphanylidene]cyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [ditert-butyl(phenoxy)-λ5-phosphanylidene]cyanamide?
The IUPAC name of [ditert-butyl(phenoxy)-λ5-phosphanylidene]cyanamide (CID 25242129) is [ditert-butyl(phenoxy)-λ5-phosphanylidene]cyanamide.
What is the SMILES notation for [ditert-butyl(phenoxy)-λ5-phosphanylidene]cyanamide?
The canonical SMILES for [ditert-butyl(phenoxy)-λ5-phosphanylidene]cyanamide is CC(C)(C)P(=NC#N)(Oc1ccccc1)C(C)(C)C.
What is the InChIKey of [ditert-butyl(phenoxy)-λ5-phosphanylidene]cyanamide?
The InChIKey is YOJGMBFANNFKNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N2OP/c1-14(2,3)19(17-12-16,15(4,5)6)18-13-10-8-7-9-11-13/h7-11H,1-6H3.
What are the key properties of [ditert-butyl(phenoxy)-λ5-phosphanylidene]cyanamide?
[ditert-butyl(phenoxy)-λ5-phosphanylidene]cyanamide has a molecular weight of 278.34 g/mol, XLogP of 5.26, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [ditert-butyl(phenoxy)-λ5-phosphanylidene]cyanamide is sourced from PubChem (CID 25242129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).