C20H23Cl2NO5 — CID 25242458
3-chloro-5-[2-hydroxy-3-[(1-hydroxy-2-methylpropan-2-yl)amino]propoxy]xanthen-9-one;hydrochloride (PubChem CID 25242458) has the molecular formula C20H23Cl2NO5 and a molecular weight of 428.31 g/mol. Its IUPAC name is 3-chloro-5-[2-hydroxy-3-[(1-hydroxy-2-methylpropan-2-yl)amino]propoxy]xanthen-9-one;hydrochloride.
| Compound Name | 3-chloro-5-[2-hydroxy-3-[(1-hydroxy-2-methylpropan-2-yl)amino]propoxy]xanthen-9-one;hydrochloride |
|---|---|
| PubChem CID | 25242458 |
| Molecular Formula | C20H23Cl2NO5 |
| Molecular Weight | 428.31 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 3-chloro-5-[2-hydroxy-3-[(1-hydroxy-2-methylpropan-2-yl)amino]propoxy]xanthen-9-one;hydrochloride |
| SMILES | CC(C)(CO)NCC(O)COc1cccc2c(=O)c3ccc(Cl)cc3oc12.Cl |
| InChI | InChI=1S/C20H22ClNO5.ClH/c1-20(2,11-23)22-9-13(24)10-26-16-5-3-4-15-18(25)14-7-6-12(21)8-17(14)27-19(15)16;/h3-8,13,22-24H,9-11H2,1-2H3;1H |
| InChIKey | COULJSFWDXHWIY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|