C17H25F3OSi — CID 25242885
triethyl-[(E)-4,4,4-trifluoro-1-(4-methoxyphenyl)but-2-en-2-yl]silane (PubChem CID 25242885) has the molecular formula C17H25F3OSi and a molecular weight of 330.47 g/mol. Its IUPAC name is triethyl-[(E)-4,4,4-trifluoro-1-(4-methoxyphenyl)but-2-en-2-yl]silane.
| Compound Name | triethyl-[(E)-4,4,4-trifluoro-1-(4-methoxyphenyl)but-2-en-2-yl]silane |
|---|---|
| PubChem CID | 25242885 |
| Molecular Formula | C17H25F3OSi |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | triethyl-[(E)-4,4,4-trifluoro-1-(4-methoxyphenyl)but-2-en-2-yl]silane |
| SMILES | CC[Si](CC)(CC)/C(=C/C(F)(F)F)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C17H25F3OSi/c1-5-22(6-2,7-3)16(13-17(18,19)20)12-14-8-10-15(21-4)11-9-14/h8-11,13H,5-7,12H2,1-4H3/b16-13+ |
| InChIKey | ZFBHCYBAJYGCCJ-DTQAZKPQSA-N |
| XLogP | 5.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|