C17H26F2O2Si — CID 25243269
(E)-4,4-difluoro-1-(4-methoxyphenyl)-2-triethylsilylbut-2-en-1-ol (PubChem CID 25243269) has the molecular formula C17H26F2O2Si and a molecular weight of 328.48 g/mol. Its IUPAC name is (E)-4,4-difluoro-1-(4-methoxyphenyl)-2-triethylsilylbut-2-en-1-ol.
| Compound Name | (E)-4,4-difluoro-1-(4-methoxyphenyl)-2-triethylsilylbut-2-en-1-ol |
|---|---|
| PubChem CID | 25243269 |
| Molecular Formula | C17H26F2O2Si |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (E)-4,4-difluoro-1-(4-methoxyphenyl)-2-triethylsilylbut-2-en-1-ol |
| SMILES | CC[Si](CC)(CC)/C(=C/C(F)F)C(O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C17H26F2O2Si/c1-5-22(6-2,7-3)15(12-16(18)19)17(20)13-8-10-14(21-4)11-9-13/h8-12,16-17,20H,5-7H2,1-4H3/b15-12+ |
| InChIKey | WYMTYNKJNLEJBR-NTCAYCPXSA-N |
| XLogP | 4.97 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|