C17H26F2OSi — CID 25243104
[(E)-1,1-difluoro-4-(4-methoxyphenyl)but-2-en-2-yl]-triethylsilane (PubChem CID 25243104) has the molecular formula C17H26F2OSi and a molecular weight of 312.48 g/mol. Its IUPAC name is [(E)-1,1-difluoro-4-(4-methoxyphenyl)but-2-en-2-yl]-triethylsilane.
| Compound Name | [(E)-1,1-difluoro-4-(4-methoxyphenyl)but-2-en-2-yl]-triethylsilane |
|---|---|
| PubChem CID | 25243104 |
| Molecular Formula | C17H26F2OSi |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | [(E)-1,1-difluoro-4-(4-methoxyphenyl)but-2-en-2-yl]-triethylsilane |
| SMILES | CC[Si](CC)(CC)/C(=C/Cc1ccc(OC)cc1)C(F)F |
| InChI | InChI=1S/C17H26F2OSi/c1-5-21(6-2,7-3)16(17(18)19)13-10-14-8-11-15(20-4)12-9-14/h8-9,11-13,17H,5-7,10H2,1-4H3/b16-13+ |
| InChIKey | VDTQTWRNGGQHLU-DTQAZKPQSA-N |
| XLogP | 5.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|