C7H15N3O2 — CID 25244460
(2S)-6-amino-2-formamidohexanamide (PubChem CID 25244460) has the molecular formula C7H15N3O2 and a molecular weight of 173.22 g/mol. Its IUPAC name is (2S)-6-amino-2-formamidohexanamide.
| Compound Name | (2S)-6-amino-2-formamidohexanamide |
|---|---|
| PubChem CID | 25244460 |
| Molecular Formula | C7H15N3O2 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | (2S)-6-amino-2-formamidohexanamide |
| SMILES | NCCCC[C@H](NC=O)C(N)=O |
| InChI | InChI=1S/C7H15N3O2/c8-4-2-1-3-6(7(9)12)10-5-11/h5-6H,1-4,8H2,(H2,9,12)(H,10,11)/t6-/m0/s1 |
| InChIKey | DKPYGQKMNSGPGT-LURJTMIESA-N |
| XLogP | -1.28 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|