C23H21Cl2NO4S2 — CID 25246707
(5E)-5-[[3,5-dichloro-2-[2-(2-methoxy-4-prop-2-enylphenoxy)ethoxy]phenyl]methylidene]-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 25246707) has the molecular formula C23H21Cl2NO4S2 and a molecular weight of 510.46 g/mol. Its IUPAC name is (5E)-5-[[3,5-dichloro-2-[2-(2-methoxy-4-prop-2-enylphenoxy)ethoxy]phenyl]methylidene]-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[3,5-dichloro-2-[2-(2-methoxy-4-prop-2-enylphenoxy)ethoxy]phenyl]methylidene]-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 25246707 |
| Molecular Formula | C23H21Cl2NO4S2 |
| Molecular Weight | 510.46 g/mol |
| Exact Mass | 509.03 |
| IUPAC Name | (5E)-5-[[3,5-dichloro-2-[2-(2-methoxy-4-prop-2-enylphenoxy)ethoxy]phenyl]methylidene]-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | C=CCc1ccc(OCCOc2c(Cl)cc(Cl)cc2/C=C2/SC(=S)N(C)C2=O)c(OC)c1 |
| InChI | InChI=1S/C23H21Cl2NO4S2/c1-4-5-14-6-7-18(19(10-14)28-3)29-8-9-30-21-15(11-16(24)13-17(21)25)12-20-22(27)26(2)23(31)32-20/h4,6-7,10-13H,1,5,8-9H2,2-3H3/b20-12+ |
| InChIKey | LTBZTVLGUTYHEY-UDWIEESQSA-N |
| XLogP | 6.02 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.46 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|