C18H11Cl4NO2S2 — CID 3810365
5-[[3,5-dichloro-2-[(2,6-dichlorophenyl)methoxy]phenyl]methylidene]-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 3810365) has the molecular formula C18H11Cl4NO2S2 and a molecular weight of 479.24 g/mol. Its IUPAC name is 5-[[3,5-dichloro-2-[(2,6-dichlorophenyl)methoxy]phenyl]methylidene]-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[3,5-dichloro-2-[(2,6-dichlorophenyl)methoxy]phenyl]methylidene]-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3810365 |
| Molecular Formula | C18H11Cl4NO2S2 |
| Molecular Weight | 479.24 g/mol |
| Exact Mass | 476.90 |
| IUPAC Name | 5-[[3,5-dichloro-2-[(2,6-dichlorophenyl)methoxy]phenyl]methylidene]-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CN1C(=O)C(=Cc2cc(Cl)cc(Cl)c2OCc2c(Cl)cccc2Cl)SC1=S |
| InChI | InChI=1S/C18H11Cl4NO2S2/c1-23-17(24)15(27-18(23)26)6-9-5-10(19)7-14(22)16(9)25-8-11-12(20)3-2-4-13(11)21/h2-7H,8H2,1H3 |
| InChIKey | XRQOFSFWSAMHHJ-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.24 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|