C21H17NO5 — CID 25249733
[3-(8-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl] furan-2-carboxylate (PubChem CID 25249733) has the molecular formula C21H17NO5 and a molecular weight of 363.37 g/mol. Its IUPAC name is [3-(8-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl] furan-2-carboxylate.
| Compound Name | [3-(8-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 25249733 |
| Molecular Formula | C21H17NO5 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | [3-(8-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl] furan-2-carboxylate |
| SMILES | CC1=CC2CC1C1C(=O)N(c3cccc(OC(=O)c4ccco4)c3)C(=O)C21 |
| InChI | InChI=1S/C21H17NO5/c1-11-8-12-9-15(11)18-17(12)19(23)22(20(18)24)13-4-2-5-14(10-13)27-21(25)16-6-3-7-26-16/h2-8,10,12,15,17-18H,9H2,1H3 |
| InChIKey | RBIGPNFLNCPHOH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|