C26H26FN5O5 — CID 25253046
8-amino-6-[[3-(benzimidazol-1-yl)-2-hydroxypropyl]amino]-7-fluoro-10-oxospiro[4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-2,1'-cyclopentane]-11-carboxylic acid (PubChem CID 25253046) has the molecular formula C26H26FN5O5 and a molecular weight of 507.52 g/mol. Its IUPAC name is 8-amino-6-[[3-(benzimidazol-1-yl)-2-hydroxypropyl]amino]-7-fluoro-10-oxospiro[4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-2,1'-cyclopentane]-11-carboxylic acid.
| Compound Name | 8-amino-6-[[3-(benzimidazol-1-yl)-2-hydroxypropyl]amino]-7-fluoro-10-oxospiro[4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-2,1'-cyclopentane]-11-carboxylic acid |
|---|---|
| PubChem CID | 25253046 |
| Molecular Formula | C26H26FN5O5 |
| Molecular Weight | 507.52 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | 8-amino-6-[[3-(benzimidazol-1-yl)-2-hydroxypropyl]amino]-7-fluoro-10-oxospiro[4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-2,1'-cyclopentane]-11-carboxylic acid |
| SMILES | Nc1c(F)c(NCC(O)Cn2cnc3ccccc32)c2c3c1c(=O)c(C(=O)O)cn3C1(CCCC1)CO2 |
| InChI | InChI=1S/C26H26FN5O5/c27-19-20(28)18-22-24(21(19)29-9-14(33)10-31-13-30-16-5-1-2-6-17(16)31)37-12-26(7-3-4-8-26)32(22)11-15(23(18)34)25(35)36/h1-2,5-6,11,13-14,29,33H,3-4,7-10,12,28H2,(H,35,36) |
| InChIKey | SGOFUVFFFPFHAD-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 144.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.52 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|